Products 914636-51-4
CAS 914636-51-4 is the registry number for 2,3-diaza-4-phenyl-1-(3-phenylprop-2-enyloxy)buta-1,3-dienylamine. Offered by: Biosynth. Available pack sizes: 250mg.
[(E)-3-phenylprop-2-enyl] N'-[(E)-benzylideneamino]carbamimidate (CAS 914636-51-4) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: [(E)-3-phenylprop-2-enyl] N'-[(E)-benzylideneamino]carbamimidate. InChIKey: PMNLGKLHMQHPAB-DXGLHLNISA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enyl] N'-[(E)-benzylideneamino]carbamimidate |
| InChIKey | PMNLGKLHMQHPAB-DXGLHLNISA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CO/C(=N/N=C/C2=CC=CC=C2)/N |
Computed by PubChem (NCBI)