CAS 914937-12-5 appears in our catalog under these names: 3-benzyl-6-nitro-3-azabicyclo[3.1.0]hexane-2,4-dione, 95%, 95%, 3-Benzyl-6-nitro-3-azabicyclo[3.1.0]hexane-2,4-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-benzyl-6-nitro-3-azabicyclo[3.1.0]hexane-2,4-dione (CAS 914937-12-5) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 3-benzyl-6-nitro-3-azabicyclo[3.1.0]hexane-2,4-dione. InChIKey: WQIUUYJXPBMPQC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 3-benzyl-6-nitro-3-azabicyclo[3.1.0]hexane-2,4-dione |
| InChIKey | WQIUUYJXPBMPQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3C(C3[N+](=O)[O-])C2=O |
Computed by PubChem (NCBI)