CAS 915203-84-8 is the registry number for 5-Acetyl-(4-methoxy phenoxy)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-[6-(4-methoxyphenoxy)-3-pyridinyl]ethanone (CAS 915203-84-8) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 1-[6-(4-methoxyphenoxy)-3-pyridinyl]ethanone. InChIKey: PSQJFDSGYVOTBS-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-[6-(4-methoxyphenoxy)-3-pyridinyl]ethanone |
| InChIKey | PSQJFDSGYVOTBS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)