Products 91539-82-1
CAS 91539-82-1 appears in our catalog under these names: 4–Chloro–N，N–dimethylquinazolin–2–amine, 4-Chloro-N,N-dimethylquinazolin-2-amine, 4-Chloro-N,N-dimethylquinazolin-2-amine 97%, 1-(4-Chloroquinazolin-2-yl)-N,N-dimethylmethanamine, 97%, 97%, 1-(4-CHLOROQUINAZOLIN-2-YL)-N,N-DIMETHYLMETHANAMINE, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 0,5g, 250mg, 1g.
1-(4-chloroquinazolin-2-yl)-N,N-dimethylmethanamine (CAS 91539-82-1) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 1-(4-chloroquinazolin-2-yl)-N,N-dimethylmethanamine. InChIKey: FOYZORGYMUFUBD-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 1-(4-chloroquinazolin-2-yl)-N,N-dimethylmethanamine |
| InChIKey | FOYZORGYMUFUBD-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC2=CC=CC=C2C(=N1)Cl |
Computed by PubChem (NCBI)