CAS 91562-58-2 appears in our catalog under these names: 2,5-Dimethyl-3-phenylpyrrolidine hydrochloride, 98%, 2,5-Dimethyl-3-phenylpyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,5-dimethyl-3-phenylpyrrolidine;hydrochloride (CAS 91562-58-2) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 2,5-dimethyl-3-phenylpyrrolidine;hydrochloride. InChIKey: VKSOAXHTIQWIPM-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 2,5-dimethyl-3-phenylpyrrolidine;hydrochloride |
| InChIKey | VKSOAXHTIQWIPM-UHFFFAOYSA-N |
| SMILES | CC1CC(C(N1)C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)