CAS 91567-15-6 is the registry number for 3,4-Dimethyl-1-[(4-methylphenyl)sulfonyl]-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrazole (CAS 91567-15-6) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrazole. InChIKey: QDQCEFAVBNYVAC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrazole |
| InChIKey | QDQCEFAVBNYVAC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C(=N2)C)C |
Computed by PubChem (NCBI)