CAS 91573-23-8 is the registry number for N-Acetyl-N-(2,6-dimethylphenyl)acetamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-acetyl-N-(2,6-dimethylphenyl)acetamide (CAS 91573-23-8) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: N-acetyl-N-(2,6-dimethylphenyl)acetamide. InChIKey: ARTQQPCXEQDEEE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | N-acetyl-N-(2,6-dimethylphenyl)acetamide |
| InChIKey | ARTQQPCXEQDEEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(C(=O)C)C(=O)C |
Computed by PubChem (NCBI)