CAS 915764-62-4 is the registry number for Malvone A. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 50mg, 100mg, Get quote.
5,6-dihydroxy-3-methoxy-2-methylnaphthalene-1,4-dione (CAS 915764-62-4) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: 5,6-dihydroxy-3-methoxy-2-methylnaphthalene-1,4-dione. InChIKey: OIOGANSTEUPDQT-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 5,6-dihydroxy-3-methoxy-2-methylnaphthalene-1,4-dione |
| InChIKey | OIOGANSTEUPDQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)C=CC(=C2O)O)OC |
Computed by PubChem (NCBI)