Products 916420-90-1
CAS 916420-90-1 appears in our catalog under these names: 4-Methoxy-2-(trifluoromethyl)phenylacetic acid, 95%, 2-(4-Methoxy-2-(trifluoromethyl)phenyl)acetic acid, 95+%, 4-Methoxy-2-(trifluoromethyl)phenylacetic acid, 4-Methoxy-2-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2,5g.
2-[4-methoxy-2-(trifluoromethyl)phenyl]acetic acid (CAS 916420-90-1) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-[4-methoxy-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: ZAOJHEOIUQVOEU-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-[4-methoxy-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | ZAOJHEOIUQVOEU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)