CAS 916440-65-8 is the registry number for methyl (2R,3S)-2-{[(tert-butoxy)carbonyl]amino}-3-methylpentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 916440-65-8) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: KLRYBAAAYDFIEQ-DTWKUNHWSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | KLRYBAAAYDFIEQ-DTWKUNHWSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)