Products 916895-89-1
CAS 916895-89-1 appears in our catalog under these names: 3-(2-Aminoethyl)-1h-pyrrolo[2,3-b]pyridin-5-ol, 95%, 95%, 3-(2-Aminoethyl)-1H-pyrrolo[2,3-b]pyridin-5-ol, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
3-(2-aminoethyl)-1H-pyrrolo[2,3-b]pyridin-5-ol (CAS 916895-89-1) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-pyrrolo[2,3-b]pyridin-5-ol. InChIKey: MAIBYZPMDIUQQD-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-pyrrolo[2,3-b]pyridin-5-ol |
| InChIKey | MAIBYZPMDIUQQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)CCN)O |
Computed by PubChem (NCBI)