Products 917572-30-6

CAS 917572-30-6 is the registry number for (R)-(4-Benzyl-morpholin-3-yl)-acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[(3R)-4-benzylmorpholin-3-yl]acetate (CAS 917572-30-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: methyl 2-[(3R)-4-benzylmorpholin-3-yl]acetate. InChIKey: NDALEGUOVNXIKT-CYBMUJFWSA-N.

Identity
Molecular formulaC14H19NO3
Molecular weight249.30 g/mol
IUPAC namemethyl 2-[(3R)-4-benzylmorpholin-3-yl]acetate
InChIKeyNDALEGUOVNXIKT-CYBMUJFWSA-N
SMILESCOC(=O)C[C@@H]1COCCN1CC2=CC=CC=C2

Computed by PubChem (NCBI)