CAS 91766-96-0 appears in our catalog under these names: 2-Chloro-5-(piperidin-1-ylcarbonyl)aniline, 95%, 2-Chloro-5-(1-piperidinylcarbonyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
(3-amino-4-chlorophenyl)-piperidin-1-ylmethanone (CAS 91766-96-0) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: (3-amino-4-chlorophenyl)-piperidin-1-ylmethanone. InChIKey: HASRYCYCAUWJKD-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (3-amino-4-chlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | HASRYCYCAUWJKD-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)