CAS 91808-45-6 appears in our catalog under these names: N-Methyl-2,4-dinitroaniline-d3, N-Methyl-2,4-dinitroaniline-D₃. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2,4-dinitro-N-(trideuteriomethyl)aniline (CAS 91808-45-6) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 200.17 g/mol. IUPAC name: 2,4-dinitro-N-(trideuteriomethyl)aniline. InChIKey: IQEJEZOCXWJNKR-FIBGUPNXSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 2,4-dinitro-N-(trideuteriomethyl)aniline |
| InChIKey | IQEJEZOCXWJNKR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)