CAS 918300-40-0 is the registry number for 6-Bromo-7-methoxychroman-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-7-methoxy-2,3-dihydrochromen-4-one (CAS 918300-40-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 6-bromo-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: VACOWMHHLJKXTC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 6-bromo-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | VACOWMHHLJKXTC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=O)CCOC2=C1)Br |
Computed by PubChem (NCBI)