CAS 919036-50-3 appears in our catalog under these names: 6-Formyl-2,4-dimethyl-4H-thieno(3,2-b)pyrrole-5-carboxylic acid, 98%, 6-Formyl-2,4-dimethyl-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-formyl-2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid (CAS 919036-50-3) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 6-formyl-2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: UGFVUPMCZFWRGG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 6-formyl-2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | UGFVUPMCZFWRGG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C(=C(N2C)C(=O)O)C=O |
Computed by PubChem (NCBI)