CAS 919278-50-5 appears in our catalog under these names: 3-(2,2,2-Trifluoro-1-methoxyethyl)aniline, 98%, 3-(2,2,2-Trifluoro-1-methoxyethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
3-(2,2,2-trifluoro-1-methoxyethyl)aniline (CAS 919278-50-5) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 3-(2,2,2-trifluoro-1-methoxyethyl)aniline. InChIKey: MDTSXKRJXZROCS-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-(2,2,2-trifluoro-1-methoxyethyl)aniline |
| InChIKey | MDTSXKRJXZROCS-UHFFFAOYSA-N |
| SMILES | COC(C1=CC(=CC=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)