Products 919354-60-2
CAS 919354-60-2 is the registry number for (2,5-Dimethylphenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,5-dimethylphenyl)methanesulfonamide (CAS 919354-60-2) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: (2,5-dimethylphenyl)methanesulfonamide. InChIKey: CCCUCYFIXUXQDL-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | (2,5-dimethylphenyl)methanesulfonamide |
| InChIKey | CCCUCYFIXUXQDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CS(=O)(=O)N |
Computed by PubChem (NCBI)