CAS 919354-71-5 is the registry number for 1-(3,4-Difluorophenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(3,4-difluorophenyl)methanesulfonamide (CAS 919354-71-5) is a chemical compound with the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. IUPAC name: (3,4-difluorophenyl)methanesulfonamide. InChIKey: UJAAPRXILBMJQK-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO2S |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (3,4-difluorophenyl)methanesulfonamide |
| InChIKey | UJAAPRXILBMJQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CS(=O)(=O)N)F)F |
Computed by PubChem (NCBI)