CAS 91940-84-0 appears in our catalog under these names: 2–(tert–Butyl)isonicotinic acid, 2-(tert-Butyl)isonicotinic acid 96%, 4-Pyridinecarboxylic acid, 2-(1,1-dimethylethyl)-, 96%, 96%, 2-(tert-Butyl)isonicotinic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
2-tert-butylpyridine-4-carboxylic acid (CAS 91940-84-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-tert-butylpyridine-4-carboxylic acid. InChIKey: ZVXZKPSVWZIJNW-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-tert-butylpyridine-4-carboxylic acid |
| InChIKey | ZVXZKPSVWZIJNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)