CAS 91957-25-4 is the registry number for (2,5,7-Trimethyl-1h-indol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(2,5,7-trimethyl-1H-indol-3-yl)acetic acid (CAS 91957-25-4) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 2-(2,5,7-trimethyl-1H-indol-3-yl)acetic acid. InChIKey: UEEPPNNQZQTJMO-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-(2,5,7-trimethyl-1H-indol-3-yl)acetic acid |
| InChIKey | UEEPPNNQZQTJMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(N2)C)CC(=O)O)C |
Computed by PubChem (NCBI)