CAS 92-91-1 appears in our catalog under these names: 1-([1,1'-Biphenyl]-4-yl)ethanone, 98%, 4-Acetylbiphenyl, 4-Acetyl Biphenyl, 4–Acetyl–biphenyl, 4-Acetylbiphenyl, 98% . Offered by: Fluorochem, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g, 500g, 1kg, 50g, 4x25mg, 25mg, 0,5kg.
1-(4-phenylphenyl)ethanone (CAS 92-91-1) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1-(4-phenylphenyl)ethanone. InChIKey: QCZZSANNLWPGEA-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-(4-phenylphenyl)ethanone |
| InChIKey | QCZZSANNLWPGEA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)