CAS 920438-26-2 is the registry number for 1-Ethyl-5,6-dimethyl-1h-benzimidazole-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-ethyl-5,6-dimethylbenzimidazole-2-carbaldehyde (CAS 920438-26-2) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 1-ethyl-5,6-dimethylbenzimidazole-2-carbaldehyde. InChIKey: HGMYIQIVNITZRC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 1-ethyl-5,6-dimethylbenzimidazole-2-carbaldehyde |
| InChIKey | HGMYIQIVNITZRC-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C(=C2)C)C)N=C1C=O |
Computed by PubChem (NCBI)