Products 920512-75-0
CAS 920512-75-0 appears in our catalog under these names: (S)-2-(3-methoxyphenyl)piperidinehydrochloride, 95%, (S)-2-(3-Methoxyphenyl)piperidine (hydrochloride), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(3-methoxyphenyl)piperidine;hydrochloride (CAS 920512-75-0) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: (2S)-2-(3-methoxyphenyl)piperidine;hydrochloride. InChIKey: BTSSKUMKYPGJFM-YDALLXLXSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | (2S)-2-(3-methoxyphenyl)piperidine;hydrochloride |
| InChIKey | BTSSKUMKYPGJFM-YDALLXLXSA-N |
| SMILES | COC1=CC=CC(=C1)[C@@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)