CAS 920757-35-3 is the registry number for N-(Methoxycarbonyl)-L-tert-leucine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2S)-3,3-dimethyl-2-(trideuteriomethoxycarbonylamino)butanoic acid (CAS 920757-35-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 192.23 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-(trideuteriomethoxycarbonylamino)butanoic acid. InChIKey: NWPRXAIYBULIEI-XCLVWWIOSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-(trideuteriomethoxycarbonylamino)butanoic acid |
| InChIKey | NWPRXAIYBULIEI-XCLVWWIOSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)N[C@H](C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)