Products 92135-04-1

CAS 92135-04-1 is the registry number for 1,2-Benzenedicarboxylic Acid 1-(5-Methylhexyl) Ester. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

2-(5-methylhexoxycarbonyl)benzoic acid (CAS 92135-04-1) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: 2-(5-methylhexoxycarbonyl)benzoic acid. InChIKey: JKEXECONEPQHOO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O4
Molecular weight264.32 g/mol
IUPAC name2-(5-methylhexoxycarbonyl)benzoic acid
InChIKeyJKEXECONEPQHOO-UHFFFAOYSA-N
SMILESCC(C)CCCCOC(=O)C1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)