Products 92137-90-1
CAS 92137-90-1 appears in our catalog under these names: CRBN ligand-881, 99.30%, 3-(4-Aminophenyl)piperidine-2,6-dione, 97%, 3-(4-Aminophenyl)piperidine-2,6-dione, 98%. Offered by: MedChemExpress, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100 mg, 250 mg, 500 mg, 250mg, 1g, 5g, 100mg, 50mg.
3-(4-aminophenyl)piperidine-2,6-dione (CAS 92137-90-1) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(4-aminophenyl)piperidine-2,6-dione. InChIKey: JVJPHIBFEJRVNE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(4-aminophenyl)piperidine-2,6-dione |
| InChIKey | JVJPHIBFEJRVNE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)