Products 921623-04-3

CAS 921623-04-3 is the registry number for 4-(2,2-Difluoroethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(2,2-difluoroethoxy)benzoic acid (CAS 921623-04-3) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 4-(2,2-difluoroethoxy)benzoic acid. InChIKey: JPXVLMHHANYKKW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O3
Molecular weight202.15 g/mol
IUPAC name4-(2,2-difluoroethoxy)benzoic acid
InChIKeyJPXVLMHHANYKKW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OCC(F)F

Computed by PubChem (NCBI)