Products 921927-87-9
CAS 921927-87-9 appears in our catalog under these names: (2S,4R)-4-Amino-2-methyl-5-phenylpentanoic acid hydrochloride, 98%, 98%, (2S,4R)-4-Amino-2-methyl-5-phenylpentanoic acid hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S,4R)-4-amino-2-methyl-5-phenylpentanoic acid;hydrochloride (CAS 921927-87-9) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: (2S,4R)-4-amino-2-methyl-5-phenylpentanoic acid;hydrochloride. InChIKey: UQYQCBIKWHIMKS-QLSWKGBWSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | (2S,4R)-4-amino-2-methyl-5-phenylpentanoic acid;hydrochloride |
| InChIKey | UQYQCBIKWHIMKS-QLSWKGBWSA-N |
| SMILES | C[C@@H](C[C@H](CC1=CC=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)