Products 92260-83-8
CAS 92260-83-8 appears in our catalog under these names: Zilpaterol Impurity 1, Desisopropyl Zilpaterol Hydrochloride, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(9R,10R)-10-amino-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one;hydrochloride (CAS 92260-83-8) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: (9R,10R)-10-amino-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one;hydrochloride. InChIKey: BUWHTDOMEWTYMU-YZUKSGEXSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | (9R,10R)-10-amino-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one;hydrochloride |
| InChIKey | BUWHTDOMEWTYMU-YZUKSGEXSA-N |
| SMILES | C1CN2C3=C(C=CC=C3NC2=O)[C@H]([C@@H]1N)O.Cl |
Computed by PubChem (NCBI)