Products 92288-70-5
CAS 92288-70-5 appears in our catalog under these names: 2-(4-(2-Oxo-1,3-oxazolidin-3-yl)phenyl)acetic acid, 2-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetic acid, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 500mg, 100mg.
2-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetic acid (CAS 92288-70-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 2-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetic acid. InChIKey: HNCWJYWZNGZHAD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetic acid |
| InChIKey | HNCWJYWZNGZHAD-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)