CAS 923145-41-9 appears in our catalog under these names: Ethyl 2-ethyl-5-nitropyridine-3-carboxylate, 95%, Ethyl 2-ethyl-5-nitropyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Ethyl 2-ethyl-5-nitropyridine-3-carboxylate (CAS 923145-41-9) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: ethyl 2-ethyl-5-nitropyridine-3-carboxylate. InChIKey: FWGSDHOSZRZYHD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | ethyl 2-ethyl-5-nitropyridine-3-carboxylate |
| InChIKey | FWGSDHOSZRZYHD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=N1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)