Products 923239-13-8
CAS 923239-13-8 is the registry number for N-(3-Cyanophenyl)-2,5-dimethylfuran-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyanophenyl)-2,5-dimethylfuran-3-carboxamide (CAS 923239-13-8) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: N-(3-cyanophenyl)-2,5-dimethylfuran-3-carboxamide. InChIKey: XOIGYKJQXDMWEY-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | N-(3-cyanophenyl)-2,5-dimethylfuran-3-carboxamide |
| InChIKey | XOIGYKJQXDMWEY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C(=O)NC2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)