CAS 925909-06-4 is the registry number for 2',5'-Dimethoxybiphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(2,5-dimethoxyphenyl)benzoic acid (CAS 925909-06-4) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(2,5-dimethoxyphenyl)benzoic acid. InChIKey: FVBASHCIGVYJPK-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-(2,5-dimethoxyphenyl)benzoic acid |
| InChIKey | FVBASHCIGVYJPK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)