Products 926189-92-6

CAS 926189-92-6 is the registry number for 1-(Methoxyacetyl)piperidine-4-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(2-methoxyacetyl)piperidine-4-carboxylic acid (CAS 926189-92-6) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-(2-methoxyacetyl)piperidine-4-carboxylic acid. InChIKey: GRBKUNDIHRGCFY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO4
Molecular weight201.22 g/mol
IUPAC name1-(2-methoxyacetyl)piperidine-4-carboxylic acid
InChIKeyGRBKUNDIHRGCFY-UHFFFAOYSA-N
SMILESCOCC(=O)N1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)