CAS 926201-77-6 appears in our catalog under these names: 3-Chloro-4-[(morpholin-4-yl)carbonyl]aniline, 96%, 3-Chloro-4-((morpholin-4-yl)carbonyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
(4-amino-2-chlorophenyl)-morpholin-4-ylmethanone (CAS 926201-77-6) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: (4-amino-2-chlorophenyl)-morpholin-4-ylmethanone. InChIKey: PFROQKWMWAATAB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (4-amino-2-chlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | PFROQKWMWAATAB-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)