Products 926224-41-1
CAS 926224-41-1 is the registry number for 1-(4-Nitrophenyl)piperidine-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
1-(4-nitrophenyl)piperidine-3-carboxylic acid (CAS 926224-41-1) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: 1-(4-nitrophenyl)piperidine-3-carboxylic acid. InChIKey: VEAIWASLIKZFDF-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperidine-3-carboxylic acid |
| InChIKey | VEAIWASLIKZFDF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)