CAS 926232-21-5 appears in our catalog under these names: (Z)-3-Bromo-5-ethoxy-N',4-dihydroxybenzene-1-carboximidamide, 95%, (Z)-3-Bromo-5-ethoxy-N',4-dihydroxybenzene-1-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-bromo-5-ethoxy-N',4-dihydroxybenzenecarboximidamide (CAS 926232-21-5) is a chemical compound with the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. IUPAC name: 3-bromo-5-ethoxy-N',4-dihydroxybenzenecarboximidamide. InChIKey: LZBCWYUQVTUPCT-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 3-bromo-5-ethoxy-N',4-dihydroxybenzenecarboximidamide |
| InChIKey | LZBCWYUQVTUPCT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)/C(=N/O)/N)Br)O |
Computed by PubChem (NCBI)