CAS 926246-95-9 is the registry number for 2-(2-(Cyclopropanecarboxamido)thiazol-4-yl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-[2-(cyclopropanecarbonylamino)-1,3-thiazol-4-yl]acetic acid (CAS 926246-95-9) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 2-[2-(cyclopropanecarbonylamino)-1,3-thiazol-4-yl]acetic acid. InChIKey: KJGBIOSXIXCOGE-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-[2-(cyclopropanecarbonylamino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | KJGBIOSXIXCOGE-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)