Products 926252-31-5
CAS 926252-31-5 appears in our catalog under these names: 5-Fluoroquinoline-8-carboxylic acid, 5-Fluoroquinoline-8-carboxylic acid 98%, 5-FLUOROQUINOLINE-8-CARBOXYLIC ACID, 98%, 5-fluoroquinoline-8-carboxylic acid, 98%, 98%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g, 500mg.
5-fluoroquinoline-8-carboxylic acid (CAS 926252-31-5) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 5-fluoroquinoline-8-carboxylic acid. InChIKey: QDCIGTQRYOCLAT-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 5-fluoroquinoline-8-carboxylic acid |
| InChIKey | QDCIGTQRYOCLAT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
8-Quinolinecarboxylic acid, 5-fluoro-