CAS 926266-27-5 appears in our catalog under these names: 2-{((4-phenylphenyl)methyl)amino}acetamide, 95%, 2-{((4-Phenylphenyl)methyl)amino}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-[(4-phenylphenyl)methylamino]acetamide (CAS 926266-27-5) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 2-[(4-phenylphenyl)methylamino]acetamide. InChIKey: FJAMEVUFMLLKDY-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-[(4-phenylphenyl)methylamino]acetamide |
| InChIKey | FJAMEVUFMLLKDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CNCC(=O)N |
Computed by PubChem (NCBI)