CAS 92629-11-3 appears in our catalog under these names: 5-Bromo-2-phenyloxazole 97%, 5-Bromo-2-phenyloxazole, 97%, 97%, 5-Bromo-2-phenyloxazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
5-bromo-2-phenyl-1,3-oxazole (CAS 92629-11-3) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromo-2-phenyl-1,3-oxazole. InChIKey: MSXVETKZQOUBNB-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromo-2-phenyl-1,3-oxazole |
| InChIKey | MSXVETKZQOUBNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(O2)Br |
Computed by PubChem (NCBI)