Products 926913-59-9

CAS 926913-59-9 is the registry number for 1,3-Dimethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 926913-59-9) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: GOHHCEGCQPODCB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O2
Molecular weight208.14 g/mol
IUPAC name1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid
InChIKeyGOHHCEGCQPODCB-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1C(=O)O)C(F)(F)F)C

Computed by PubChem (NCBI)