CAS 926913-59-9 is the registry number for 1,3-Dimethyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 926913-59-9) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: GOHHCEGCQPODCB-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 1,3-dimethyl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | GOHHCEGCQPODCB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)O)C(F)(F)F)C |
Computed by PubChem (NCBI)