Products 927802-56-0
CAS 927802-56-0 appears in our catalog under these names: Methyl 3-amino-4-isopropoxybenzoate, 95+%, Methyl 3-amino-4-isopropoxybenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g.
Methyl 3-amino-4-propan-2-yloxybenzoate (CAS 927802-56-0) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl 3-amino-4-propan-2-yloxybenzoate. InChIKey: CXEMBXXFMPWKTJ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | methyl 3-amino-4-propan-2-yloxybenzoate |
| InChIKey | CXEMBXXFMPWKTJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(=O)OC)N |
Computed by PubChem (NCBI)