CAS 92812-22-1 appears in our catalog under these names: Cis-3-amino-2,2-dimethylcyclobutanecarboxylic acid hydrochloride, 95%, rel-(1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylic acid hydrochloride, 97%, cis-3-amino-2,2-dimethylcyclobutanecarboxylic acid hcl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 0,5g, 50mg.
Trans-(1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylic acid;hydrochloride (CAS 92812-22-1) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-(1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylic acid;hydrochloride. InChIKey: HMDTZGADNNOTKS-FHAQVOQBSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-(1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | HMDTZGADNNOTKS-FHAQVOQBSA-N |
| SMILES | CC1([C@@H](C[C@@H]1N)C(=O)O)C.Cl |
Computed by PubChem (NCBI)