Products 1965309-07-2

CAS 1965309-07-2 appears in our catalog under these names: 6-Methylpiperidine-3-carboxylic acid hydrochloride, 95%, 6-Methyl-piperidine-3-carboxylic acid hydrochloride, 98%, 6-Methyl-piperidine-3-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 10g, 1g, 0,5g.

Structural formula: {0} (CAS {1})

6-methylpiperidine-3-carboxylic acid;hydrochloride (CAS 1965309-07-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 6-methylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: NJNNMKIITLUFIE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name6-methylpiperidine-3-carboxylic acid;hydrochloride
InChIKeyNJNNMKIITLUFIE-UHFFFAOYSA-N
SMILESCC1CCC(CN1)C(=O)O.Cl

Computed by PubChem (NCBI)