CAS 180196-56-9 appears in our catalog under these names: (1R,3S)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, 97%, (1R,3S)–Methyl 3–aminocyclopentanecarboxylate hydrochloride, methyl (1R,3S)-3-aminocyclopentane-1-carboxylate hydrochloride, (1R,3S)-Methyl 3-aminocyclopentanecarboxylate hydrochloride 95%, (1R,3S)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25g, 5g, 10g, 100mg, 2,5g, 500mg.
Cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 180196-56-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)