Products 1185298-24-1

CAS 1185298-24-1 appears in our catalog under these names: 1-(AMINOMETHYL)CYCLOPENTANECARBOXYLIC A&, 1-(Aminomethyl)cyclopentanecarboxylic acid hydrochloride, 1-(Aminomethyl)cyclopentanecarboxylic acid hydrochloride, 95%. Offered by: Sigma-Aldrich, Biosynth, Combi-blocks. Available pack sizes: 500MG, 2,5g, 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

1-(aminomethyl)cyclopentane-1-carboxylic acid;hydrochloride (CAS 1185298-24-1) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 1-(aminomethyl)cyclopentane-1-carboxylic acid;hydrochloride. InChIKey: RQZKNSBTUBWVJG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name1-(aminomethyl)cyclopentane-1-carboxylic acid;hydrochloride
InChIKeyRQZKNSBTUBWVJG-UHFFFAOYSA-N
SMILESC1CCC(C1)(CN)C(=O)O.Cl

Computed by PubChem (NCBI)