Products 929095-34-1
CAS 929095-34-1 appears in our catalog under these names: 3-Hydroxy-4-nitrobenzyl pivalate, 98%, 98%, 3-Hydroxy-4-nitrobenzyl pivalate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3-hydroxy-4-nitrophenyl)methyl 2,2-dimethylpropanoate (CAS 929095-34-1) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (3-hydroxy-4-nitrophenyl)methyl 2,2-dimethylpropanoate. InChIKey: ZZICZUSDFRAIAP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (3-hydroxy-4-nitrophenyl)methyl 2,2-dimethylpropanoate |
| InChIKey | ZZICZUSDFRAIAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCC1=CC(=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)