Products 929101-24-6

CAS 929101-24-6 is the registry number for 2,5-Dioxo-1-pyrrolidinyl 2-(Ethenylthio)ethyl Carbonate. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfanylethyl carbonate (CAS 929101-24-6) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfanylethyl carbonate. InChIKey: NWYNYIVFWNPUEA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO5S
Molecular weight245.25 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfanylethyl carbonate
InChIKeyNWYNYIVFWNPUEA-UHFFFAOYSA-N
SMILESC=CSCCOC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)